Infobox drug/testcases-FDA |  | |
Pronunciation | acetylsalicylic acid |
---|
Trade names | Bayer Aspirin, others |
---|
Other names | - 2-acetoxybenzoic acid
- o-acetylsalicylic acid
- acetylsalicylic acid
- acetyl salicylate
|
---|
AHFS/Drugs.com | Monograph |
---|
MedlinePlus | a682878 |
---|
License data |
|
---|
Pregnancy category | |
---|
Routes of administration | By mouth, rectal |
---|
ATC code | |
---|
|
Legal status |
|
---|
|
Bioavailability | 80–100%[8] |
---|
Protein binding | 80–90%[9] |
---|
Metabolism | Liver (CYP2C19 and possibly CYP3A), some is also hydrolysed to salicylate in the gut wall.[9] |
---|
Elimination half-life | Dose-dependent; 2–3 h for low doses (100 mg or less), 15–30 h for large doses.[9] |
---|
Excretion | Urine (80–100%), sweat, saliva, feces[8] |
---|
|
2-acetyloxybenzoic acid [10]
| CAS Number | |
---|
PubChem CID | |
---|
IUPHAR/BPS | |
---|
DrugBank | |
---|
ChemSpider | |
---|
UNII | |
---|
KEGG | |
---|
ChEBI | |
---|
ChEMBL | |
---|
PDB ligand | |
---|
|
Formula | C9H8O4 |
---|
Molar mass | 180.159 g·mol−1 |
---|
3D model (JSmol) | |
---|
Density | 1.40 g/cm3 |
---|
Melting point | 136 °C (277 °F) [5] |
---|
Boiling point | 140 °C (284 °F) (decomposes) |
---|
Solubility in water | 3 g/L |
---|
|
InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) YKey:BSYNRYMUTXBXSQ-UHFFFAOYSA-N Y
| (verify) | |
Infobox drug/testcases-FDA |  | |
Pronunciation | acetylsalicylic acid |
---|
Trade names | Bayer Aspirin, others |
---|
Other names | - 2-acetoxybenzoic acid
- o-acetylsalicylic acid
- acetylsalicylic acid
- acetyl salicylate
|
---|
AHFS/Drugs.com | Monograph |
---|
MedlinePlus | a682878 |
---|
License data |
|
---|
Pregnancy category | |
---|
Routes of administration | By mouth, rectal |
---|
ATC code | |
---|
|
Legal status |
|
---|
|
Bioavailability | 80–100%[8] |
---|
Protein binding | 80–90%[9] |
---|
Metabolism | Liver (CYP2C19 and possibly CYP3A), some is also hydrolysed to salicylate in the gut wall.[9] |
---|
Elimination half-life | Dose-dependent; 2–3 h for low doses (100 mg or less), 15–30 h for large doses.[9] |
---|
Excretion | Urine (80–100%), sweat, saliva, feces[8] |
---|
|
2-acetyloxybenzoic acid [10]
| CAS Number | |
---|
PubChem CID | |
---|
IUPHAR/BPS | |
---|
DrugBank | |
---|
ChemSpider | |
---|
UNII | |
---|
KEGG | |
---|
ChEBI | |
---|
ChEMBL | |
---|
PDB ligand | |
---|
|
Formula | C9H8O4 |
---|
Molar mass | 180.159 g·mol−1 |
---|
3D model (JSmol) | |
---|
Density | 1.40 g/cm3 |
---|
Melting point | 136 °C (277 °F) [5] |
---|
Boiling point | 140 °C (284 °F) (decomposes) |
---|
Solubility in water | 3 g/L |
---|
|
InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) YKey:BSYNRYMUTXBXSQ-UHFFFAOYSA-N Y
| (verify) | |