Template:Infobox drug/testcases11

__EXPECTUNUSEDTEMPLATE__

• Merge Template:Infobox neurohormone(edit talk links history) into Template:Infobox drug(edit talk links history) (2017)
• Add gene therapy section (2018)

This testcase page uses {{Infobox drug/sandbox}}. Diff: compare (pages: Template:Infobox drug, Template:Infobox drug/sandbox).

• Testing Gene therapy

Infobox drug development (Drugbox - talk central, overview, sandboxes, testcases) WT:PHARM

/sandbox: {{Drugbox}} · {{title}} ·  · src {{licence}} ·  · src {{legal}} ·  · src {{pregcat}} ·  · src {{molarmass}} ·  · src {{mab source}} ·  · src {{localINNvar}} ·  · src {{maint cat}} ·  · src {{fmtATC}} ·  · src /format · Infobox drug/sandbox (edit · t · history · diff · links · /test · Source · e · t · hist · links · /subpages · /doc · /doc edit) FDA-2023 {{Infobox drug/doc/FDA-2023}} · /testcases-FDA -- 2023  · /sandbox2 parameters Full parameter list () · Type-conditional sections TPU cats:Category:Infobox drug tracking categories (24): Category:Pages using infobox drug with unknown parameters (7) · Parameter usage report cat:IBdrug templates · cat:Templates used in IBdrug testcases (m view): Template:Infobox drug/testcases -- General /testcases2 -- titles, licence, EMA /testcases3 -- pregcat, legal, licence, PLLR, ATC; Wikidata /testcases4 -- chem formula, mab /testcases5 -- identifiers, second id's /testcases6 -- all up /testcases7images -- images /testcases8 -- type, titles /testcases9 -- order variants, container_only /testcases10 -- pharmacokinetic, localINN (2017) has (data page) -- is a redirect /testcases11 -- hormone, gene therapy (2018), has (data page) /testcases-FDA -- FDA 2023 /testcases-warning -- warning box(es) RC recent changes Chem+Drugbox templates · Drugbox transclusions Module:TemplatePar bot Settings.css · Settings/sandbox · {{cascite}} chembox {{Chem/dev/nav}} · {{Chembox}} Infobox drug class/sandbox (edit · t · history · diff · links · /test · Source · e · t · hist · links · /subpages · /doc · /doc edit)

• Diff: compare (pages: Template:Infobox drug, Template:Infobox drug/sandbox).

Has (data page)

Template:Infobox drug/testcases11 (data page)

This page has a data page to test this situation. (example: Caffeine has Caffeine (data page))

(data page)

Jan 2022: |data page=

This testpage has DP: Template:Infobox drug/testcases11 (data page)

(new) {{Infobox drug/data page link}}

• |data page= absent (dflt)

Side by side comparison

{{Infobox drug}}	{{Infobox drug/sandbox}}
Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dflt Data page Template:Infobox drug/testcases11 (data page)	Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dflt Data page Template:Infobox drug/testcases11 (data page)

• |data page=<blank>

Side by side comparison

{{Infobox drug}}	{{Infobox drug/sandbox}}
Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=blank Data page Template:Infobox drug/testcases11 (data page)	Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=blank Data page Template:Infobox drug/testcases11 (data page)

|data page=Water (data page)

Side by side comparison

{{Infobox drug}}	{{Infobox drug/sandbox}}
Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=water(DP) Data page Water (data page)	Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=water(DP) Data page Water (data page)

|data page=[[Water (data page)]]

Side by side comparison

{{Infobox drug}}	{{Infobox drug/sandbox}}
Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=[water(DP)] Data page Water (data page)	Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=[water(DP)] Data page Water (data page)

|data page=none

Side by side comparison

{{Infobox drug}}	{{Infobox drug/sandbox}}
Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=none	Infobox drug/testcases11 Clinical data Pronunciation test (DP) -dp=none

other older

|data page=Water (data page)

|dat_ page=Foobar (xyz page)

Gene therapy

• Pilot article is Voretigene neparvovec

2

Testcase 1

Testcase comparing the previous template (now deprecated)

nowiki

{| style="vertical-align:top" |- | colspan=2 | [[Oxytocin]] |- | {{tl|Infobox drug/sandbox}} | {{tl|Infobox neurohormone}} |- |{{Infobox drug/sandbox | type= | drug_name = Oxytocin (hormone) | IUPAC_name = 1-({(4''R'',7''S'',10''S'',13''S'',16''S'',19''R'')-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-(4-hydroxybenzyl)-13-[(1''S'')-1-methylpropyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl}carbonyl)-<small>L</small>-prolyl-<small>L</small>-leucylglycinamide | image = Oxytocin with labels.png | width = 250px <!-- Physiology --> | source_tissues = [[posterior pituitary]] | target_tissues = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | biosynthesis = [[magnolysin]] | metabolism = [[oxytocinase]] | legal_US= blabla-test | class = clinicalclass <!--Pharmacokinetic data--> | bioavailability = | protein_bound = 30% <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} |{{Infobox neurohormone <!-- Nomenclature and image --> | name = Oxytocin (hormone) | alt = <!--alt text for screenreaders--> | IUPACName = 1-({(4''R'',7''S'',10''S'',13''S'',16''S'',19''R'')-19-amino-7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-16-(4-hydroxybenzyl)-13-[(1''S'')-1-methylpropyl]-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl}carbonyl)-<small>L</small>-prolyl-<small>L</small>-leucylglycinamide | synonyms = | abbrev = <!--abbreviated name--> | image = Oxytocin with labels.png <!-- Neuropharmacology --> | sources = [[posterior pituitary]] | targets = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | synth = [[magnolysin]] | breakdown = [[oxytocinase]] <!-- Database links --> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N | footnotes = }} |}

test metabolism in two sections

{{Infobox drug/sandbox}}

text metabolism, and pronunciation

nowiki

{{tl|Infobox drug/sandbox}} {{testcase table | type= | drug_name = M. with physiological data only | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | source_tissues = [[posterior pituitary]] | target_tissues = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | biosynthesis = [[magnolysin]] | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = | protein_bound = <!-- 30% --> <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} {{testcase table | type= | drug_name = M. with pharmacokinetic data only | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = xyz | protein_bound = 30% <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} {{testcase table | type= | drug_name = M. with physio and pharmacokin data both | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | source_tissues = [[posterior pituitary]] | target_tissues = [[central nervous system]] | receptors = [[oxytocin receptor]] | agonists = [[carbetocin]], [[demoxytocin]], [[merotocin]] | antagonists = [[atosiban]], [[epelsiban]], [[retosiban]] | precursor = [[Neurophysin I|oxytocin-neurophysin 1]] | biosynthesis = [[magnolysin]] | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = xyz | protein_bound = 30% <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol | smiles = CC[C@H](C)[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H](N)CSSC[C@H](NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC1=O)C(=O)N3CCC[C@H]3C(=O)N[C@@H](CC(C)C)C(=O)NCC(N)=O | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C43H66N12O12S2/c1-5-22(4)35-42(66)49-26(12-13-32(45)57)38(62)51-29(17-33(46)58)39(63)53-30(20-69-68-19-25(44)36(60)50-28(40(64)54-35)16-23-8-10-24(56)11-9-23)43(67)55-14-6-7-31(55)41(65)52-27(15-21(2)3)37(61)48-18-34(47)59/h8-11,21-22,25-31,35,56H,5-7,12-20,44H2,1-4H3,(H2,45,57)(H2,46,58)(H2,47,59)(H,48,61)(H,49,66)(H,50,60)(H,51,62)(H,52,65)(H,53,63)(H,54,64)/t22-,25-,26-,27-,28-,29-,30-,31-,35-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = XNOPRXBHLZRZKH-DSZYJQQASA-N }} {{testcase table | type= | drug_name = M. with M. value only | IUPAC_name = | pronounce = {{IPAc-en|ˌ|ɒ|k|s|ᵻ|ˈ|t|oʊ|s|ɪ|n}} | image = Aspirin-skeletal.svg <!-- Physiology --> | source_tissues = | target_tissues = | receptors = | agonists = | antagonists = | precursor = | biosynthesis = | metabolism = [[oxytocinase]] <!--Pharmacokinetic data--> | bioavailability = | protein_bound = <!--Identifiers--> | CAS_number_Ref = {{cascite|correct}} | CAS_number = 50-56-6 <!--Chemical data--> | C=43 | H=66 | N=12 | O=12 | S=2 | molecular_weight = 1007.19 g/mol }}