From English Wikipedia @ Freddythechick
Medication
Homopipramol |
|
ATC code | |
---|
|
4-(3-(5H-Dibenz(b,f)azepin-5-yl)propyl)hexahydro-1H-1,4-diazepine-1-ethanol
|
CAS Number | |
---|
PubChem CID | |
---|
ChemSpider | |
---|
UNII | |
---|
ChEMBL | |
---|
|
Formula | C24H25N3O |
---|
Molar mass | 371.484 g·mol−1 |
---|
3D model (JSmol) | |
---|
OCCN1CCCN(CCCN2C3=CC=CC=C3C=CC3=CC=CC=C23)CC1
|
InChI=1S/C24H31N3O/c28-20-19-26-14-5-13-25(17-18-26)15-6-16-27-23-9-3-1-7-21(23)11-12-22-8-2-4-10-24(22)27/h1-4,7-12,28H,5-6,13-20H2 Key:AXJPNVUUDXTSOL-UHFFFAOYSA-N
|
Homopipramol is a tricyclic antidepressant and antipsychotic which was never marketed.[1]
See also
References
|
---|
|
---|
SSRIsTooltip Selective serotonin reuptake inhibitors | |
---|
SNRIsTooltip Serotonin–norepinephrine reuptake inhibitors | |
---|
NRIsTooltip Norepinephrine reuptake inhibitors | |
---|
NDRIsTooltip Norepinephrine–dopamine reuptake inhibitors | |
---|
NaSSAsTooltip Noradrenergic and specific serotonergic antidepressants | |
---|
SARIsTooltip Serotonin antagonist and reuptake inhibitors | |
---|
SMSTooltip Serotonin modulator and stimulators | |
---|
Others | |
---|
|
|
|
---|
TCAsTooltip Tricyclic antidepressants | |
---|
TeCAsTooltip Tetracyclic antidepressants | |
---|
Others | |
---|
|
|
|
---|
Non-selective | |
---|
MAOATooltip Monoamine oxidase A-selective | |
---|
MAOBTooltip Monoamine oxidase B-selective | |
---|
|
|
|
|
|